C17H21IN2 — CID 24761597
4-[(E)-2-(1,5-dimethylpyridin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide (PubChem CID 24761597) has the molecular formula C17H21IN2 and a molecular weight of 380.27 g/mol. Its IUPAC name is 4-[(E)-2-(1,5-dimethylpyridin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-(1,5-dimethylpyridin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 24761597 |
| Molecular Formula | C17H21IN2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 4-[(E)-2-(1,5-dimethylpyridin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
| SMILES | Cc1ccc(/C=C/c2ccc(N(C)C)cc2)[n+](C)c1.[I-] |
| InChI | InChI=1S/C17H21N2.HI/c1-14-5-9-17(19(4)13-14)12-8-15-6-10-16(11-7-15)18(2)3;/h5-13H,1-4H3;1H/q+1;/p-1 |
| InChIKey | DFRBIKWTAAEZHP-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|