C26H30N3+ — CID 5111246
4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 5111246) has the molecular formula C26H30N3+ and a molecular weight of 384.55 g/mol. Its IUPAC name is 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 5111246 |
| Molecular Formula | C26H30N3+ |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=Cc2cc[n+](C)c(C=Cc3ccc(N(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C26H30N3/c1-27(2)24-13-8-21(9-14-24)6-7-23-18-19-29(5)26(20-23)17-12-22-10-15-25(16-11-22)28(3)4/h6-20H,1-5H3/q+1 |
| InChIKey | YJVPUYQIQXFOCX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|