C23H23N4+ — CID 12605819
4-[(E)-2-[4-(1H-benzimidazol-2-yl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 12605819) has the molecular formula C23H23N4+ and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-[(E)-2-[4-(1H-benzimidazol-2-yl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-(1H-benzimidazol-2-yl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 12605819 |
| Molecular Formula | C23H23N4+ |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 4-[(E)-2-[4-(1H-benzimidazol-2-yl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc(-c3nc4ccccc4[nH]3)cc[n+]2C)cc1 |
| InChI | InChI=1S/C23H22N4/c1-26(2)19-11-8-17(9-12-19)10-13-20-16-18(14-15-27(20)3)23-24-21-6-4-5-7-22(21)25-23/h4-16H,1-3H3/p+1/b13-10+ |
| InChIKey | RZGSQPJVBDHTAA-JLHYYAGUSA-O |
| XLogP | 4.29 |
| TPSA | 35.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|