C15H14ClN3 — CID 168555503
4-(1H-benzimidazol-2-yl)-3-chloro-N,N-dimethylaniline (PubChem CID 168555503) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-3-chloro-N,N-dimethylaniline.
| Compound Name | 4-(1H-benzimidazol-2-yl)-3-chloro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 168555503 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-3-chloro-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3ccccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClN3/c1-19(2)10-7-8-11(12(16)9-10)15-17-13-5-3-4-6-14(13)18-15/h3-9H,1-2H3,(H,17,18) |
| InChIKey | OUPGLFBWQDOWRG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |