C18H21N3 — CID 168554266
4-(1H-benzimidazol-2-yl)-N,N-diethyl-3-methylaniline (PubChem CID 168554266) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N,N-diethyl-3-methylaniline.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 168554266 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(-c2nc3ccccc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C18H21N3/c1-4-21(5-2)14-10-11-15(13(3)12-14)18-19-16-8-6-7-9-17(16)20-18/h6-12H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | JVNFWYQOIOCWFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |