C19H19Cl2N3O — CID 168552127
2-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3H-quinazolin-4-one (PubChem CID 168552127) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is 2-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552127 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3H-quinazolin-4-one |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19Cl2N3O/c1-13-12-14(24(10-8-20)11-9-21)6-7-15(13)18-22-17-5-3-2-4-16(17)19(25)23-18/h2-7,12H,8-11H2,1H3,(H,22,23,25) |
| InChIKey | RWULZAOKFNMDLD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|