C15H11FN2O3S — CID 168553310
2-(2-fluoro-4-methylsulfonylphenyl)-3H-quinazolin-4-one (PubChem CID 168553310) has the molecular formula C15H11FN2O3S and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylsulfonylphenyl)-3H-quinazolin-4-one.
| Compound Name | 2-(2-fluoro-4-methylsulfonylphenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168553310 |
| Molecular Formula | C15H11FN2O3S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-(2-fluoro-4-methylsulfonylphenyl)-3H-quinazolin-4-one |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3ccccc3c(=O)[nH]2)c(F)c1 |
| InChI | InChI=1S/C15H11FN2O3S/c1-22(20,21)9-6-7-10(12(16)8-9)14-17-13-5-3-2-4-11(13)15(19)18-14/h2-8H,1H3,(H,17,18,19) |
| InChIKey | QCPFEUQYFLMPSJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |