C21H16N2O4S — CID 168552318
[2-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 168552318) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is [2-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168552318 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [2-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2-c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H16N2O4S/c1-14-10-12-15(13-11-14)28(25,26)27-19-9-5-3-7-17(19)20-22-18-8-4-2-6-16(18)21(24)23-20/h2-13H,1H3,(H,22,23,24) |
| InChIKey | QPMWFIGVHWATSO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|