C15H13ClN2 — CID 168554186
2-(4-chloro-2,5-dimethylphenyl)-1H-benzimidazole (PubChem CID 168554186) has the molecular formula C15H13ClN2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethylphenyl)-1H-benzimidazole.
| Compound Name | 2-(4-chloro-2,5-dimethylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 168554186 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(4-chloro-2,5-dimethylphenyl)-1H-benzimidazole |
| SMILES | Cc1cc(-c2nc3ccccc3[nH]2)c(C)cc1Cl |
| InChI | InChI=1S/C15H13ClN2/c1-9-8-12(16)10(2)7-11(9)15-17-13-5-3-4-6-14(13)18-15/h3-8H,1-2H3,(H,17,18) |
| InChIKey | RNAMATIWUIJJKI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |