C41H40N6O4 — CID 146405991
3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one;7-(diethylamino)-3-(1-methylbenzimidazol-2-yl)chromen-2-one (PubChem CID 146405991) has the molecular formula C41H40N6O4 and a molecular weight of 680.81 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one;7-(diethylamino)-3-(1-methylbenzimidazol-2-yl)chromen-2-one.
| Compound Name | 3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one;7-(diethylamino)-3-(1-methylbenzimidazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 146405991 |
| Molecular Formula | C41H40N6O4 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one;7-(diethylamino)-3-(1-methylbenzimidazol-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4ccccc4[nH]3)c(=O)oc2c1.CCN(CC)c1ccc2cc(-c3nc4ccccc4n3C)c(=O)oc2c1 |
| InChI | InChI=1S/C21H21N3O2.C20H19N3O2/c1-4-24(5-2)15-11-10-14-12-16(21(25)26-19(14)13-15)20-22-17-8-6-7-9-18(17)23(20)3;1-3-23(4-2)14-10-9-13-11-15(20(24)25-18(13)12-14)19-21-16-7-5-6-8-17(16)22-19/h6-13H,4-5H2,1-3H3;5-12H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | LOVPBTROAIKAOU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|