C20H19N3O5S — CID 137458930
2-[7-(diethylamino)-2-oxochromen-3-yl]-3H-benzimidazole-5-sulfonic acid (PubChem CID 137458930) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[7-(diethylamino)-2-oxochromen-3-yl]-3H-benzimidazole-5-sulfonic acid.
| Compound Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-3H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 137458930 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-3H-benzimidazole-5-sulfonic acid |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4ccc(S(=O)(=O)O)cc4[nH]3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H19N3O5S/c1-3-23(4-2)13-6-5-12-9-15(20(24)28-18(12)10-13)19-21-16-8-7-14(29(25,26)27)11-17(16)22-19/h5-11H,3-4H2,1-2H3,(H,21,22)(H,25,26,27) |
| InChIKey | KOJMVXKDTAKKBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|