C27H26N4O5S — CID 101459729
2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(4-methoxyphenyl)-3H-benzimidazole-5-sulfonamide (PubChem CID 101459729) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(4-methoxyphenyl)-3H-benzimidazole-5-sulfonamide.
| Compound Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(4-methoxyphenyl)-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 101459729 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(4-methoxyphenyl)-3H-benzimidazole-5-sulfonamide |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4ccc(S(=O)(=O)Nc5ccc(OC)cc5)cc4[nH]3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H26N4O5S/c1-4-31(5-2)19-9-6-17-14-22(27(32)36-25(17)15-19)26-28-23-13-12-21(16-24(23)29-26)37(33,34)30-18-7-10-20(35-3)11-8-18/h6-16,30H,4-5H2,1-3H3,(H,28,29) |
| InChIKey | OIIZKUONNIQLPT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|