C24H27N3O5S2 — CID 15538581
2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(3-methoxypropyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 15538581) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(3-methoxypropyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(3-methoxypropyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 15538581 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[7-(diethylamino)-2-oxochromen-3-yl]-N-(3-methoxypropyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4ccc(S(=O)(=O)NCCCOC)cc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-4-27(5-2)17-8-7-16-13-19(24(28)32-21(16)14-17)23-26-20-10-9-18(15-22(20)33-23)34(29,30)25-11-6-12-31-3/h7-10,13-15,25H,4-6,11-12H2,1-3H3 |
| InChIKey | TWIWAIFIWQKSTM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|