C24H26N2O2S — CID 22088884
3-(5-butyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one (PubChem CID 22088884) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-(5-butyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one.
| Compound Name | 3-(5-butyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 22088884 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-(5-butyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
| SMILES | CCCCc1ccc2sc(-c3cc4ccc(N(CC)CC)cc4oc3=O)nc2c1 |
| InChI | InChI=1S/C24H26N2O2S/c1-4-7-8-16-9-12-22-20(13-16)25-23(29-22)19-14-17-10-11-18(26(5-2)6-3)15-21(17)28-24(19)27/h9-15H,4-8H2,1-3H3 |
| InChIKey | NFZWETBQBHWBPL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|