C30H26N2O4S — CID 20723911
(4-ethenylphenyl)methyl 2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazole-6-carboxylate (PubChem CID 20723911) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-ethenylphenyl)methyl 2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 20723911 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzothiazole-6-carboxylate |
| SMILES | C=Cc1ccc(COC(=O)c2ccc3nc(-c4cc5ccc(N(CC)CC)cc5oc4=O)sc3c2)cc1 |
| InChI | InChI=1S/C30H26N2O4S/c1-4-19-7-9-20(10-8-19)18-35-29(33)22-12-14-25-27(16-22)37-28(31-25)24-15-21-11-13-23(32(5-2)6-3)17-26(21)36-30(24)34/h4,7-17H,1,5-6,18H2,2-3H3 |
| InChIKey | RCVOYQLVVNUQAC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|