C25H22N2O2S — CID 58927036
7-(diethylamino)-3-(7-methylbenzo[e][1,3]benzothiazol-2-yl)chromen-2-one (PubChem CID 58927036) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 7-(diethylamino)-3-(7-methylbenzo[e][1,3]benzothiazol-2-yl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-(7-methylbenzo[e][1,3]benzothiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 58927036 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 7-(diethylamino)-3-(7-methylbenzo[e][1,3]benzothiazol-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4c(ccc5cc(C)ccc54)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H22N2O2S/c1-4-27(5-2)18-9-7-17-13-20(25(28)29-21(17)14-18)24-26-23-19-10-6-15(3)12-16(19)8-11-22(23)30-24/h6-14H,4-5H2,1-3H3 |
| InChIKey | GRLXEWHVHVAXPI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|