C21H23NO2 — CID 71659817
7-(diethylamino)-3-(2,4-dimethylphenyl)chromen-2-one (PubChem CID 71659817) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 7-(diethylamino)-3-(2,4-dimethylphenyl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-(2,4-dimethylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 71659817 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 7-(diethylamino)-3-(2,4-dimethylphenyl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(C)cc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C21H23NO2/c1-5-22(6-2)17-9-8-16-12-19(21(23)24-20(16)13-17)18-10-7-14(3)11-15(18)4/h7-13H,5-6H2,1-4H3 |
| InChIKey | OMVYWWVQIAKMMX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|