C16H17N3O2S — CID 13126342
3-(2-amino-1,3-thiazol-4-yl)-7-(diethylamino)chromen-2-one (PubChem CID 13126342) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-7-(diethylamino)chromen-2-one.
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 13126342 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3csc(N)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C16H17N3O2S/c1-3-19(4-2)11-6-5-10-7-12(13-9-22-16(17)18-13)15(20)21-14(10)8-11/h5-9H,3-4H2,1-2H3,(H2,17,18) |
| InChIKey | XYMISFWIUUPXII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|