C14H11NO2S — CID 142841478
7-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one (PubChem CID 142841478) has the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 7-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one.
| Compound Name | 7-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 142841478 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 7-methyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-2-one |
| SMILES | Cc1ccc2cc(-c3csc(C)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C14H11NO2S/c1-8-3-4-10-6-11(12-7-18-9(2)15-12)14(16)17-13(10)5-8/h3-7H,1-2H3 |
| InChIKey | WGXFMOPPXSIUKF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|