C14H11NO3 — CID 162687769
7-methyl-3-(4-methyl-1,3-oxazol-2-yl)chromen-2-one (PubChem CID 162687769) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 7-methyl-3-(4-methyl-1,3-oxazol-2-yl)chromen-2-one.
| Compound Name | 7-methyl-3-(4-methyl-1,3-oxazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 162687769 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 7-methyl-3-(4-methyl-1,3-oxazol-2-yl)chromen-2-one |
| SMILES | Cc1ccc2cc(-c3nc(C)co3)c(=O)oc2c1 |
| InChI | InChI=1S/C14H11NO3/c1-8-3-4-10-6-11(13-15-9(2)7-17-13)14(16)18-12(10)5-8/h3-7H,1-2H3 |
| InChIKey | VVUYZJZSSNZAIV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|