C20H13N3O2S — CID 139218805
3-[5-(1H-indol-2-yl)-1,3,4-thiadiazol-2-yl]-7-methylchromen-2-one (PubChem CID 139218805) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 3-[5-(1H-indol-2-yl)-1,3,4-thiadiazol-2-yl]-7-methylchromen-2-one.
| Compound Name | 3-[5-(1H-indol-2-yl)-1,3,4-thiadiazol-2-yl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 139218805 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-[5-(1H-indol-2-yl)-1,3,4-thiadiazol-2-yl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2cc(-c3nnc(-c4cc5ccccc5[nH]4)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H13N3O2S/c1-11-6-7-13-9-14(20(24)25-17(13)8-11)18-22-23-19(26-18)16-10-12-4-2-3-5-15(12)21-16/h2-10,21H,1H3 |
| InChIKey | WMNKPELTCXACOZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|