C19H15N3O2S — CID 1121734
3-[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one (PubChem CID 1121734) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 3-[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one.
| Compound Name | 3-[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 1121734 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-[5-(4-ethylanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
| SMILES | CCc1ccc(Nc2nnc(-c3cc4ccccc4oc3=O)s2)cc1 |
| InChI | InChI=1S/C19H15N3O2S/c1-2-12-7-9-14(10-8-12)20-19-22-21-17(25-19)15-11-13-5-3-4-6-16(13)24-18(15)23/h3-11H,2H2,1H3,(H,20,22) |
| InChIKey | PYOXEXWJBAZQCP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|