C19H15N3O3S — CID 3304581
3-[5-(benzylamino)-1,3,4-thiadiazol-2-yl]-7-methoxychromen-2-one (PubChem CID 3304581) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[5-(benzylamino)-1,3,4-thiadiazol-2-yl]-7-methoxychromen-2-one.
| Compound Name | 3-[5-(benzylamino)-1,3,4-thiadiazol-2-yl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 3304581 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 3-[5-(benzylamino)-1,3,4-thiadiazol-2-yl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2cc(-c3nnc(NCc4ccccc4)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H15N3O3S/c1-24-14-8-7-13-9-15(18(23)25-16(13)10-14)17-21-22-19(26-17)20-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | SOUDXYOTEJHRNQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|