C20H16ClN3O3S — CID 2911952
6-chloro-3-[5-(4-propoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one (PubChem CID 2911952) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 6-chloro-3-[5-(4-propoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one.
| Compound Name | 6-chloro-3-[5-(4-propoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 2911952 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 6-chloro-3-[5-(4-propoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
| SMILES | CCCOc1ccc(Nc2nnc(-c3cc4cc(Cl)ccc4oc3=O)s2)cc1 |
| InChI | InChI=1S/C20H16ClN3O3S/c1-2-9-26-15-6-4-14(5-7-15)22-20-24-23-18(28-20)16-11-12-10-13(21)3-8-17(12)27-19(16)25/h3-8,10-11H,2,9H2,1H3,(H,22,24) |
| InChIKey | OUYMCSULSQWIGZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|