C20H16N2O3S — CID 15263193
3-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 15263193) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 3-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 15263193 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 3-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | CCOc1ccc(Nc2nc(-c3cc4ccccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C20H16N2O3S/c1-2-24-15-9-7-14(8-10-15)21-20-22-17(12-26-20)16-11-13-5-3-4-6-18(13)25-19(16)23/h3-12H,2H2,1H3,(H,21,22) |
| InChIKey | RWMMNUSUZBOPLZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|