C21H17NO2S — CID 808318
3-[5-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]chromen-2-one (PubChem CID 808318) has the molecular formula C21H17NO2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-[5-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]chromen-2-one.
| Compound Name | 3-[5-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 808318 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[5-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]chromen-2-one |
| SMILES | CCc1sc(-c2cc3ccccc3oc2=O)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H17NO2S/c1-3-18-19(14-10-8-13(2)9-11-14)22-20(25-18)16-12-15-6-4-5-7-17(15)24-21(16)23/h4-12H,3H2,1-2H3 |
| InChIKey | GXVAUBUSWBADKU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|