C23H14N2O4S — CID 34924459
N-[2-(2-oxochromen-3-yl)-4-phenyl-1,3-thiazol-5-yl]furan-2-carboxamide (PubChem CID 34924459) has the molecular formula C23H14N2O4S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[2-(2-oxochromen-3-yl)-4-phenyl-1,3-thiazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-(2-oxochromen-3-yl)-4-phenyl-1,3-thiazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34924459 |
| Molecular Formula | C23H14N2O4S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[2-(2-oxochromen-3-yl)-4-phenyl-1,3-thiazol-5-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1sc(-c2cc3ccccc3oc2=O)nc1-c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C23H14N2O4S/c26-20(18-11-6-12-28-18)25-22-19(14-7-2-1-3-8-14)24-21(30-22)16-13-15-9-4-5-10-17(15)29-23(16)27/h1-13H,(H,25,26) |
| InChIKey | QVIWVPODONQHHQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|