C15H10N2O3S — CID 175842092
N-(4-oxo-6-phenyl-1,3-thiazin-2-yl)furan-2-carboxamide (PubChem CID 175842092) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is N-(4-oxo-6-phenyl-1,3-thiazin-2-yl)furan-2-carboxamide.
| Compound Name | N-(4-oxo-6-phenyl-1,3-thiazin-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 175842092 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | N-(4-oxo-6-phenyl-1,3-thiazin-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nc(=O)cc(-c2ccccc2)s1)c1ccco1 |
| InChI | InChI=1S/C15H10N2O3S/c18-13-9-12(10-5-2-1-3-6-10)21-15(16-13)17-14(19)11-7-4-8-20-11/h1-9H,(H,16,17,18,19) |
| InChIKey | QDFGHUTZYZZQHO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |