C12H6N4O2S2 — CID 72736597
3-(3-sulfanylidene-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)chromen-2-one (PubChem CID 72736597) has the molecular formula C12H6N4O2S2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-(3-sulfanylidene-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)chromen-2-one.
| Compound Name | 3-(3-sulfanylidene-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)chromen-2-one |
|---|---|
| PubChem CID | 72736597 |
| Molecular Formula | C12H6N4O2S2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-(3-sulfanylidene-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nn2c(=S)[nH]nc2s1 |
| InChI | InChI=1S/C12H6N4O2S2/c17-10-7(5-6-3-1-2-4-8(6)18-10)9-15-16-11(19)13-14-12(16)20-9/h1-5H,(H,13,19) |
| InChIKey | NJPXKNHWBHBOAO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|