C11H7N3O2S — CID 10514492
3-(5-amino-1,2,4-thiadiazol-3-yl)chromen-2-one (PubChem CID 10514492) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-(5-amino-1,2,4-thiadiazol-3-yl)chromen-2-one.
| Compound Name | 3-(5-amino-1,2,4-thiadiazol-3-yl)chromen-2-one |
|---|---|
| PubChem CID | 10514492 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-(5-amino-1,2,4-thiadiazol-3-yl)chromen-2-one |
| SMILES | Nc1nc(-c2cc3ccccc3oc2=O)ns1 |
| InChI | InChI=1S/C11H7N3O2S/c12-11-13-9(14-17-11)7-5-6-3-1-2-4-8(6)16-10(7)15/h1-5H,(H2,12,13,14) |
| InChIKey | IAOWYRAKLUVLHT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|