C15H14ClN3O3 — CID 120863265
3-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride (PubChem CID 120863265) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is 3-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride.
| Compound Name | 3-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 120863265 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3cc4ccccc4oc3=O)n2)CCC1 |
| InChI | InChI=1S/C15H13N3O3.ClH/c16-15(6-3-7-15)14-17-12(21-18-14)10-8-9-4-1-2-5-11(9)20-13(10)19;/h1-2,4-5,8H,3,6-7,16H2;1H |
| InChIKey | UJRDYALCBBOEQF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|