C16H16ClN3O3 — CID 120855673
3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride (PubChem CID 120855673) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride.
| Compound Name | 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 120855673 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]chromen-2-one;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3cc4ccccc4oc3=O)n2)CCCC1 |
| InChI | InChI=1S/C16H15N3O3.ClH/c17-16(7-3-4-8-16)15-18-13(22-19-15)11-9-10-5-1-2-6-12(10)21-14(11)20;/h1-2,5-6,9H,3-4,7-8,17H2;1H |
| InChIKey | HPBURJSRHJTRKQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|