C26H17N5O3S — CID 3996656
N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 3996656) has the molecular formula C26H17N5O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 3996656 |
| Molecular Formula | C26H17N5O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | Cc1nnc2sc(-c3ccc(NC(=O)c4cccc(-c5cc6ccccc6oc5=O)c4)cc3)nn12 |
| InChI | InChI=1S/C26H17N5O3S/c1-15-28-29-26-31(15)30-24(35-26)16-9-11-20(12-10-16)27-23(32)19-7-4-6-17(13-19)21-14-18-5-2-3-8-22(18)34-25(21)33/h2-14H,1H3,(H,27,32) |
| InChIKey | GDESRKVUAKKOCK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|