C23H17N3O2S — CID 3978901
2-[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]benzo[f]chromen-3-one (PubChem CID 3978901) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]benzo[f]chromen-3-one.
| Compound Name | 2-[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 3978901 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]benzo[f]chromen-3-one |
| SMILES | Cc1cccc(Nc2nnc(-c3cc4c(ccc5ccccc54)oc3=O)s2)c1C |
| InChI | InChI=1S/C23H17N3O2S/c1-13-6-5-9-19(14(13)2)24-23-26-25-21(29-23)18-12-17-16-8-4-3-7-15(16)10-11-20(17)28-22(18)27/h3-12H,1-2H3,(H,24,26) |
| InChIKey | SGAAXDHXJRKTBJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|