C25H16N2O3 — CID 12609766
2-(4,6-dimethyl-[1,3]oxazolo[4,5-c]quinolin-2-yl)benzo[f]chromen-3-one (PubChem CID 12609766) has the molecular formula C25H16N2O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-(4,6-dimethyl-[1,3]oxazolo[4,5-c]quinolin-2-yl)benzo[f]chromen-3-one.
| Compound Name | 2-(4,6-dimethyl-[1,3]oxazolo[4,5-c]quinolin-2-yl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 12609766 |
| Molecular Formula | C25H16N2O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(4,6-dimethyl-[1,3]oxazolo[4,5-c]quinolin-2-yl)benzo[f]chromen-3-one |
| SMILES | Cc1cccc2c1nc(C)c1nc(-c3cc4c(ccc5ccccc54)oc3=O)oc12 |
| InChI | InChI=1S/C25H16N2O3/c1-13-6-5-9-17-21(13)26-14(2)22-23(17)30-24(27-22)19-12-18-16-8-4-3-7-15(16)10-11-20(18)29-25(19)28/h3-12H,1-2H3 |
| InChIKey | JCSCRJOTSFGCCR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|