C25H12BrNO4S — CID 2185414
2-[2-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-4-yl]benzo[f]chromen-3-one (PubChem CID 2185414) has the molecular formula C25H12BrNO4S and a molecular weight of 502.35 g/mol. Its IUPAC name is 2-[2-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-4-yl]benzo[f]chromen-3-one.
| Compound Name | 2-[2-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2185414 |
| Molecular Formula | C25H12BrNO4S |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | 2-[2-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
| SMILES | O=c1oc2ccc3ccccc3c2cc1-c1csc(-c2cc3cc(Br)ccc3oc2=O)n1 |
| InChI | InChI=1S/C25H12BrNO4S/c26-15-6-8-21-14(9-15)10-19(25(29)30-21)23-27-20(12-32-23)18-11-17-16-4-2-1-3-13(16)5-7-22(17)31-24(18)28/h1-12H |
| InChIKey | FFWSQVJDXHODKL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|