C22H15N3O4S — CID 139218816
4,7-dimethyl-6-[[5-(2-oxochromen-3-yl)-1,3,4-thiadiazol-2-yl]amino]chromen-2-one (PubChem CID 139218816) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is 4,7-dimethyl-6-[[5-(2-oxochromen-3-yl)-1,3,4-thiadiazol-2-yl]amino]chromen-2-one.
| Compound Name | 4,7-dimethyl-6-[[5-(2-oxochromen-3-yl)-1,3,4-thiadiazol-2-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 139218816 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4,7-dimethyl-6-[[5-(2-oxochromen-3-yl)-1,3,4-thiadiazol-2-yl]amino]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(C)c2cc1Nc1nnc(-c2cc3ccccc3oc2=O)s1 |
| InChI | InChI=1S/C22H15N3O4S/c1-11-8-19(26)28-18-7-12(2)16(10-14(11)18)23-22-25-24-20(30-22)15-9-13-5-3-4-6-17(13)29-21(15)27/h3-10H,1-2H3,(H,23,25) |
| InChIKey | CIRMGGCTZDVSHU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|