C20H17N3O3S — CID 4164462
6-[(5-anilino-1,3,4-thiadiazol-2-yl)methoxy]-4,7-dimethylchromen-2-one (PubChem CID 4164462) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 6-[(5-anilino-1,3,4-thiadiazol-2-yl)methoxy]-4,7-dimethylchromen-2-one.
| Compound Name | 6-[(5-anilino-1,3,4-thiadiazol-2-yl)methoxy]-4,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4164462 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 6-[(5-anilino-1,3,4-thiadiazol-2-yl)methoxy]-4,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(C)c2cc1OCc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C20H17N3O3S/c1-12-9-19(24)26-17-8-13(2)16(10-15(12)17)25-11-18-22-23-20(27-18)21-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,21,23) |
| InChIKey | WUVYQBLBQLSUBX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|