C22H21N3O4S — CID 10002406
6-ethyl-7-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methoxy]-4-methylchromen-2-one (PubChem CID 10002406) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 6-ethyl-7-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 6-ethyl-7-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 10002406 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 6-ethyl-7-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]methoxy]-4-methylchromen-2-one |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OCc1nnc(Nc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C22H21N3O4S/c1-4-14-10-17-13(2)9-21(26)29-19(17)11-18(14)28-12-20-24-25-22(30-20)23-15-5-7-16(27-3)8-6-15/h5-11H,4,12H2,1-3H3,(H,23,25) |
| InChIKey | PEFRSSPWCRRRFZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|