C20H20O7S — CID 8823391
(6-ethyl-4-methyl-2-oxochromen-7-yl) 2,5-dimethoxybenzenesulfonate (PubChem CID 8823391) has the molecular formula C20H20O7S and a molecular weight of 404.44 g/mol. Its IUPAC name is (6-ethyl-4-methyl-2-oxochromen-7-yl) 2,5-dimethoxybenzenesulfonate.
| Compound Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 8823391 |
| Molecular Formula | C20H20O7S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2,5-dimethoxybenzenesulfonate |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H20O7S/c1-5-13-9-15-12(2)8-20(21)26-18(15)11-17(13)27-28(22,23)19-10-14(24-3)6-7-16(19)25-4/h6-11H,5H2,1-4H3 |
| InChIKey | GJZOWPQHVKQAGQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|