C22H22O6 — CID 55380662
(6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 55380662) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55380662 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H22O6/c1-5-15-11-16-13(2)8-21(23)28-19(16)12-18(15)27-22(24)10-14-6-7-17(25-3)20(9-14)26-4/h6-9,11-12H,5,10H2,1-4H3 |
| InChIKey | VPSYRKNVHZDVHE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|