C22H21N3O5 — CID 56576610
(6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 56576610) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 56576610 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OC(=O)Cc1c(C)nc2cc(=O)[nH]n2c1C |
| InChI | InChI=1S/C22H21N3O5/c1-5-14-7-15-11(2)6-21(27)30-18(15)9-17(14)29-22(28)8-16-12(3)23-19-10-20(26)24-25(19)13(16)4/h6-7,9-10H,5,8H2,1-4H3,(H,24,26) |
| InChIKey | TUUSTNDEYVXBFN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|