C25H24FNO5 — CID 46820057
(6-ethyl-4-methyl-2-oxochromen-7-yl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 46820057) has the molecular formula C25H24FNO5 and a molecular weight of 437.47 g/mol. Its IUPAC name is (6-ethyl-4-methyl-2-oxochromen-7-yl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46820057 |
| Molecular Formula | C25H24FNO5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (6-ethyl-4-methyl-2-oxochromen-7-yl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H24FNO5/c1-3-16-13-20-15(2)12-23(28)31-22(20)14-21(16)32-25(30)18-8-10-27(11-9-18)24(29)17-4-6-19(26)7-5-17/h4-7,12-14,18H,3,8-11H2,1-2H3 |
| InChIKey | MKGRKPBKQUELEF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|