C22H24FNO3 — CID 32997684
(2,3,5-trimethylphenyl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 32997684) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is (2,3,5-trimethylphenyl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | (2,3,5-trimethylphenyl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 32997684 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2,3,5-trimethylphenyl) 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | Cc1cc(C)c(C)c(OC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C22H24FNO3/c1-14-12-15(2)16(3)20(13-14)27-22(26)18-8-10-24(11-9-18)21(25)17-4-6-19(23)7-5-17/h4-7,12-13,18H,8-11H2,1-3H3 |
| InChIKey | VHJKFZBSZPYVEI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|