C25H14ClN3O2S — CID 2840096
3-(2-chloro-7-methylquinolin-3-yl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 2840096) has the molecular formula C25H14ClN3O2S and a molecular weight of 455.93 g/mol. Its IUPAC name is 3-(2-chloro-7-methylquinolin-3-yl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(2-chloro-7-methylquinolin-3-yl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2840096 |
| Molecular Formula | C25H14ClN3O2S |
| Molecular Weight | 455.93 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 3-(2-chloro-7-methylquinolin-3-yl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc2cc(C=C(C#N)c3nc(-c4cc5ccccc5oc4=O)cs3)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H14ClN3O2S/c1-14-6-7-15-9-17(23(26)28-20(15)8-14)10-18(12-27)24-29-21(13-32-24)19-11-16-4-2-3-5-22(16)31-25(19)30/h2-11,13H,1H3 |
| InChIKey | KOISPWVGTRJJJK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.93 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|