C15H15N3O3 — CID 10708251
7-(diethylamino)-3-(1,3,4-oxadiazol-2-yl)chromen-2-one (PubChem CID 10708251) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 7-(diethylamino)-3-(1,3,4-oxadiazol-2-yl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-(1,3,4-oxadiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 10708251 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 7-(diethylamino)-3-(1,3,4-oxadiazol-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3nnco3)c(=O)oc2c1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-18(4-2)11-6-5-10-7-12(14-17-16-9-20-14)15(19)21-13(10)8-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | IHONXOYAQQTZEO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|