C44H32N2O2S — CID 123958268
3-(7-cyclohexa-1,3,4,5-tetraen-1-yl-4,5,6-triphenyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one (PubChem CID 123958268) has the molecular formula C44H32N2O2S and a molecular weight of 652.82 g/mol. Its IUPAC name is 3-(7-cyclohexa-1,3,4,5-tetraen-1-yl-4,5,6-triphenyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one.
| Compound Name | 3-(7-cyclohexa-1,3,4,5-tetraen-1-yl-4,5,6-triphenyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 123958268 |
| Molecular Formula | C44H32N2O2S |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | 3-(7-cyclohexa-1,3,4,5-tetraen-1-yl-4,5,6-triphenyl-1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4c(-c5ccccc5)c(-c5ccccc5)c(-c5ccccc5)c(C5=CC=C=C=C5)c4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C44H32N2O2S/c1-3-46(4-2)34-26-25-33-27-35(44(47)48-36(33)28-34)43-45-41-39(31-21-13-7-14-22-31)37(29-17-9-5-10-18-29)38(30-19-11-6-12-20-30)40(42(41)49-43)32-23-15-8-16-24-32/h5-7,9-15,17-28H,3-4H2,1-2H3 |
| InChIKey | ZRTYQMHGNUFGKF-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|