C35H30N2O2 — CID 58612991
7-(diethylamino)-3-[4-(N-naphthalen-1-ylanilino)phenyl]chromen-2-one (PubChem CID 58612991) has the molecular formula C35H30N2O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 7-(diethylamino)-3-[4-(N-naphthalen-1-ylanilino)phenyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[4-(N-naphthalen-1-ylanilino)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 58612991 |
| Molecular Formula | C35H30N2O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 7-(diethylamino)-3-[4-(N-naphthalen-1-ylanilino)phenyl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(N(c4ccccc4)c4cccc5ccccc45)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C35H30N2O2/c1-3-36(4-2)30-22-19-27-23-32(35(38)39-34(27)24-30)26-17-20-29(21-18-26)37(28-13-6-5-7-14-28)33-16-10-12-25-11-8-9-15-31(25)33/h5-24H,3-4H2,1-2H3 |
| InChIKey | ZOGAKXTYKKJLKB-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|