C40H32N2O4 — CID 142252635
3-[7-[7-(diethylamino)-2-oxochromen-3-yl]-9-methylcarbazol-2-yl]-7-methylbenzo[h]chromen-2-one (PubChem CID 142252635) has the molecular formula C40H32N2O4 and a molecular weight of 604.71 g/mol. Its IUPAC name is 3-[7-[7-(diethylamino)-2-oxochromen-3-yl]-9-methylcarbazol-2-yl]-7-methylbenzo[h]chromen-2-one.
| Compound Name | 3-[7-[7-(diethylamino)-2-oxochromen-3-yl]-9-methylcarbazol-2-yl]-7-methylbenzo[h]chromen-2-one |
|---|---|
| PubChem CID | 142252635 |
| Molecular Formula | C40H32N2O4 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 3-[7-[7-(diethylamino)-2-oxochromen-3-yl]-9-methylcarbazol-2-yl]-7-methylbenzo[h]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc4c5ccc(-c6cc7ccc8c(C)cccc8c7oc6=O)cc5n(C)c4c3)c(=O)oc2c1 |
| InChI | InChI=1S/C40H32N2O4/c1-5-42(6-2)28-14-10-26-18-33(39(43)45-37(26)22-28)24-11-16-30-31-17-12-25(21-36(31)41(4)35(30)20-24)34-19-27-13-15-29-23(3)8-7-9-32(29)38(27)46-40(34)44/h7-22H,5-6H2,1-4H3 |
| InChIKey | OBVBDPFFBSDPPI-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 68.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|