C38H26N2O4 — CID 142252750
3-[7-(7-amino-2-oxochromen-3-yl)-9-methylcarbazol-2-yl]-7-benzylchromen-2-one (PubChem CID 142252750) has the molecular formula C38H26N2O4 and a molecular weight of 574.64 g/mol. Its IUPAC name is 3-[7-(7-amino-2-oxochromen-3-yl)-9-methylcarbazol-2-yl]-7-benzylchromen-2-one.
| Compound Name | 3-[7-(7-amino-2-oxochromen-3-yl)-9-methylcarbazol-2-yl]-7-benzylchromen-2-one |
|---|---|
| PubChem CID | 142252750 |
| Molecular Formula | C38H26N2O4 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 3-[7-(7-amino-2-oxochromen-3-yl)-9-methylcarbazol-2-yl]-7-benzylchromen-2-one |
| SMILES | Cn1c2cc(-c3cc4ccc(N)cc4oc3=O)ccc2c2ccc(-c3cc4ccc(Cc5ccccc5)cc4oc3=O)cc21 |
| InChI | InChI=1S/C38H26N2O4/c1-40-33-19-24(31-17-26-8-7-23(16-35(26)43-37(31)41)15-22-5-3-2-4-6-22)10-13-29(33)30-14-11-25(20-34(30)40)32-18-27-9-12-28(39)21-36(27)44-38(32)42/h2-14,16-21H,15,39H2,1H3 |
| InChIKey | UXSZKZVLWDGIGG-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|